| MolName | 2-[4-[(Z)-[(1,3-diphenylpyrazole-4-carbonyl)hydrazinylidene]methyl]phenoxy]acetate |
| MolecularFormula | C25H19N4O4 |
| Smiles | [O-]C(COc1ccc(/C=N\NC(c2cn(-c3ccccc3)nc2-c2ccccc2)=O)cc1)=O |
| InChI | InChI=1S/C25H20N4O4/c30-23(31)17-33-21-13-11-18(12-14-21)15-26-27-25(32)22-16-29(20-9-5-2-6-10-20)28-24(22)19-7-3-1-4-8-19/h1-16H,17H2,(H,27,32)(H,30,31)/p-1 |
| InChIK | IPGXCCOUKXJJBH-UHFFFAOYSA-M |
| TotalMolweight | 439.45 |
| Molweight | 439.45 |
| MonoisotopicMass | 439.140631 |
| CLogP | 1.1046 |
| CLogS | -5.027 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 343.51 |
| Relative PSA | 0.26541 |
| PolarSurfaceArea | 108.64 |
| Druglikeness | 6.3546 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57576 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-[(Z)-[(1,3-diphenylpyrazole-4-carbonyl)hydrazinylidene]methyl]phenoxy]acetate | 2 - 2-[4-[(Z)-[(1,3-diphenylpyrazole-4-carbonyl)hydrazinylidene]methyl]phenoxy]acetate