| MolName | 1-N,4-N-bis[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]benzene-1,4-dicarboxamide |
| MolecularFormula | C30H20N6O8 |
| Smiles | [O-][N+](c(cccc1)c1-c1ccc(/C=N\NC(c(cc2)ccc2C(N/N=C\c2ccc(-c(cccc3)c3[N+]([O-])=O)o2)=O)=O)o1)=O |
| InChI | InChI=1S/C30H20N6O8/c37-29(33-31-17-21-13-15-27(43-21)23-5-1-3-7-25(23)35(39)40)19-9-11-20(12-10-19)30(38)34-32-18-22-14-16-28(44-22)24-6-2-4-8-26(24)36(41)42/h1-18H,(H,33,37)(H,34,38) |
| InChIK | IPTSBUWFOWLBLZ-UHFFFAOYSA-N |
| TotalMolweight | 592.523 |
| Molweight | 592.523 |
| MonoisotopicMass | 592.134264 |
| CLogP | 4.7782 |
| CLogS | -9.666 |
| H Acceptors | 14 |
| H Donors | 2 |
| TotalSurfaceArea | 446.96 |
| Relative PSA | 0.36039 |
| PolarSurfaceArea | 200.84 |
| Druglikeness | 1.38 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59091 |
| Fragments | 1 |
| Non HAtoms | 44 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 2 |
| Symmetricatoms | 23 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-N,4-N-bis[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]benzene-1,4-dicarboxamide | 2 - 1-N,4-N-bis[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]benzene-1,4-dicarboxamide