| MolName | 3-hydroxy-N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]naphthalene-2-carboxamide |
| MolecularFormula | C24H23N3O5 |
| Smiles | Oc1cc2ccccc2cc1C(N/N=C\c(cc1)ccc1OCC(N1CCOCC1)=O)=O |
| InChI | InChI=1S/C24H23N3O5/c28-22-14-19-4-2-1-3-18(19)13-21(22)24(30)26-25-15-17-5-7-20(8-6-17)32-16-23(29)27-9-11-31-12-10-27/h1-8,13-15,28H,9-12,16H2,(H,26,30) |
| InChIK | IPUHTVPYEJOUKE-UHFFFAOYSA-N |
| TotalMolweight | 433.463 |
| Molweight | 433.463 |
| MonoisotopicMass | 433.163772 |
| CLogP | 3.2995 |
| CLogS | -4.521 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 331.29 |
| Relative PSA | 0.25869 |
| PolarSurfaceArea | 100.46 |
| Druglikeness | 6.0203 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-hydroxy-N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]naphthalene-2-carboxamide | 2 - 3-hydroxy-N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]naphthalene-2-carboxamide