| MolName | N-[(Z)-[5-(4-fluorophenyl)furan-2-yl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide |
| MolecularFormula | C24H15N2O3F |
| Smiles | O=C(c1cc(c2ccccc2cc2)c2o1)N/N=C\c1ccc(-c(cc2)ccc2F)o1 |
| InChI | InChI=1S/C24H15FN2O3/c25-17-8-5-16(6-9-17)21-12-10-18(29-21)14-26-27-24(28)23-13-20-19-4-2-1-3-15(19)7-11-22(20)30-23/h1-14H,(H,27,28) |
| InChIK | IQGNSINLXAKAHC-UHFFFAOYSA-N |
| TotalMolweight | 398.392 |
| Molweight | 398.392 |
| MonoisotopicMass | 398.106671 |
| CLogP | 5.9413 |
| CLogS | -8.284 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 301.68 |
| Relative PSA | 0.21291 |
| PolarSurfaceArea | 67.74 |
| Druglikeness | 5.3077 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 24 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(4-fluorophenyl)furan-2-yl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide | 2 - N-[(Z)-[5-(4-fluorophenyl)furan-2-yl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide