| MolName | 3-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1,3-diazaspiro[4.5]decane-2,4-dione |
| MolecularFormula | C17H19N3O2 |
| Smiles | O=C(C1(CCCCC1)NC1=O)N1/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C17H19N3O2/c21-15-17(11-5-2-6-12-17)19-16(22)20(15)18-13-7-10-14-8-3-1-4-9-14/h1,3-4,7-10,13H,2,5-6,11-12H2,(H,19,22) |
| InChIK | IQHKRBGSUCVPQV-UHFFFAOYSA-N |
| TotalMolweight | 297.357 |
| Molweight | 297.357 |
| MonoisotopicMass | 297.147727 |
| CLogP | 2.1691 |
| CLogS | -4.028 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 233.99 |
| Relative PSA | 0.2248 |
| PolarSurfaceArea | 61.77 |
| Druglikeness | 1.6217 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1,3-diazaspiro[4.5]decane-2,4-dione | 2 - 3-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1,3-diazaspiro[4.5]decane-2,4-dione