| MolName | (E)-3-(2,4-dichlorophenyl)-N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]prop-2-en-1-imine |
| MolecularFormula | C22H13N2OCl2F |
| Smiles | Fc(cc1)ccc1-c1nc(cc(cc2)/N=C/C=C/c(ccc(Cl)c3)c3Cl)c2o1 |
| InChI | InChI=1S/C22H13Cl2FN2O/c23-16-6-3-14(19(24)12-16)2-1-11-26-18-9-10-21-20(13-18)27-22(28-21)15-4-7-17(25)8-5-15/h1-13H |
| InChIK | IQTZLQKVMBBQOV-UHFFFAOYSA-N |
| TotalMolweight | 411.262 |
| Molweight | 411.262 |
| MonoisotopicMass | 410.038895 |
| CLogP | 6.0193 |
| CLogS | -8.226 |
| H Acceptors | 3 |
| TotalSurfaceArea | 304.28 |
| Relative PSA | 0.12025 |
| PolarSurfaceArea | 38.39 |
| Druglikeness | -1.24 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (E)-3-(2,4-dichlorophenyl)-N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]prop-2-en-1-imine | 2 - (E)-3-(2,4-dichlorophenyl)-N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]prop-2-en-1-imine