| MolName | 2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-(4-phenylphenyl)methylideneamino]acetamide |
| MolecularFormula | C28H22N4OS3 |
| Smiles | O=C(CSc1nnc(SCc2cccc3ccccc23)s1)N/N=C\c(cc1)ccc1-c1ccccc1 |
| InChI | InChI=1S/C28H22N4OS3/c33-26(30-29-17-20-13-15-22(16-14-20)21-7-2-1-3-8-21)19-35-28-32-31-27(36-28)34-18-24-11-6-10-23-9-4-5-12-25(23)24/h1-17H,18-19H2,(H,30,33) |
| InChIK | IQZJGUCGBLKHGY-UHFFFAOYSA-N |
| TotalMolweight | 526.708 |
| Molweight | 526.708 |
| MonoisotopicMass | 526.095571 |
| CLogP | 7.2666 |
| CLogS | -10.032 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 397.07 |
| Relative PSA | 0.28531 |
| PolarSurfaceArea | 146.08 |
| Druglikeness | 5.1323 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-(4-phenylphenyl)methylideneamino]acetamide | 2 - 2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-(4-phenylphenyl)methylideneamino]acetamide