| MolName | (Z)-1-[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C14H10N6OS |
| Smiles | C(c(o1)ccc1Sc1nc(cccc2)c2[nH]1)=N\n1cnnc1 |
| InChI | InChI=1S/C14H10N6OS/c1-2-4-12-11(3-1)18-14(19-12)22-13-6-5-10(21-13)7-17-20-8-15-16-9-20/h1-9H,(H,18,19) |
| InChIK | IRKKUGPTUMTUBK-UHFFFAOYSA-N |
| TotalMolweight | 310.34 |
| Molweight | 310.34 |
| MonoisotopicMass | 310.063679 |
| CLogP | 2.1772 |
| CLogS | -5.521 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 234.37 |
| Relative PSA | 0.41336 |
| PolarSurfaceArea | 110.19 |
| Druglikeness | 6.3975 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 5 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine