| MolName | 3-(4-bromophenyl)-4-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C19H12N5O3BrS |
| Smiles | [O-][N+](c1cccc(-c2ccc(/C=N\N(C(c(cc3)ccc3Br)=NN3)C3=S)o2)c1)=O |
| InChI | InChI=1S/C19H12BrN5O3S/c20-14-6-4-12(5-7-14)18-22-23-19(29)24(18)21-11-16-8-9-17(28-16)13-2-1-3-15(10-13)25(26)27/h1-11H,(H,23,29) |
| InChIK | ISKDWFWFXSMARL-UHFFFAOYSA-N |
| TotalMolweight | 470.306 |
| Molweight | 470.306 |
| MonoisotopicMass | 468.984421 |
| CLogP | 4.0375 |
| CLogS | -7.205 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 313.47 |
| Relative PSA | 0.3527 |
| PolarSurfaceArea | 131.04 |
| Druglikeness | -0.77018 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.58621 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(4-bromophenyl)-4-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-thione | 2 - 3-(4-bromophenyl)-4-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-thione