| MolName | 1-(2,1,3-benzothiadiazol-4-yl)-3-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]urea |
| MolecularFormula | C16H13N5OS |
| Smiles | O=C(Nc1cccc2nsnc12)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C16H13N5OS/c22-16(18-13-9-4-10-14-15(13)21-23-20-14)19-17-11-5-8-12-6-2-1-3-7-12/h1-11H,(H2,18,19,22) |
| InChIK | ITCDHVCYZHZXAC-UHFFFAOYSA-N |
| TotalMolweight | 323.379 |
| Molweight | 323.379 |
| MonoisotopicMass | 323.08408 |
| CLogP | 3.7304 |
| CLogS | -1.161 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 253.01 |
| Relative PSA | 0.35481 |
| PolarSurfaceArea | 107.51 |
| Druglikeness | 5.305 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-(2,1,3-benzothiadiazol-4-yl)-3-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]urea | 2 - 1-(2,1,3-benzothiadiazol-4-yl)-3-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]urea