| MolName | 3-[5-[(Z)-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid |
| MolecularFormula | C19H9N2O3F7 |
| Smiles | OC(c1cccc(-c2ccc(/C=N\Nc(c(F)c(c(C(F)(F)F)c3F)F)c3F)o2)c1)=O |
| InChI | InChI=1S/C19H9F7N2O3/c20-13-12(19(24,25)26)14(21)16(23)17(15(13)22)28-27-7-10-4-5-11(31-10)8-2-1-3-9(6-8)18(29)30/h1-7,28H,(H,29,30) |
| InChIK | ITFXPTPWBOVMQQ-UHFFFAOYSA-N |
| TotalMolweight | 446.277 |
| Molweight | 446.277 |
| MonoisotopicMass | 446.050139 |
| CLogP | 6.5164 |
| CLogS | -6.656 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 297.65 |
| Relative PSA | 0.2124 |
| PolarSurfaceArea | 74.83 |
| Druglikeness | -2.9624 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[5-[(Z)-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid | 2 - 3-[5-[(Z)-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid