| MolName | (E)-2-[(2,4-dichloro-1,3-thiazol-5-yl)methylamino]-3-(thiophen-2-ylmethylideneamino)but-2-enedinitrile |
| MolecularFormula | C13H7N5Cl2S2 |
| Smiles | N#C/C(/NCc(sc(Cl)n1)c1Cl)=C(/C#N)\N=C\c1cccs1 |
| InChI | InChI=1S/C13H7Cl2N5S2/c14-12-11(22-13(15)20-12)7-19-10(5-17)9(4-16)18-6-8-2-1-3-21-8/h1-3,6,19H,7H2 |
| InChIK | ITRLGIDQHGOELM-UHFFFAOYSA-N |
| TotalMolweight | 368.272 |
| Molweight | 368.272 |
| MonoisotopicMass | 366.951989 |
| CLogP | 3.8215 |
| CLogS | -5.545 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 270.82 |
| Relative PSA | 0.37582 |
| PolarSurfaceArea | 141.34 |
| Druglikeness | -2.536 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.59091 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - (E)-2-[(2,4-dichloro-1,3-thiazol-5-yl)methylamino]-3-(thiophen-2-ylmethylideneamino)but-2-enedinitrile | 2 - (E)-2-[(2,4-dichloro-1,3-thiazol-5-yl)methylamino]-3-(thiophen-2-ylmethylideneamino)but-2-enedinitrile