| MolName | 4-[(Z)-[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]benzoate |
| MolecularFormula | C20H14N2O3Br |
| Smiles | [O-]C(c1ccc(/C=N\NC(Cc(c2ccccc22)ccc2Br)=O)cc1)=O |
| InChI | InChI=1S/C20H15BrN2O3/c21-18-10-9-15(16-3-1-2-4-17(16)18)11-19(24)23-22-12-13-5-7-14(8-6-13)20(25)26/h1-10,12H,11H2,(H,23,24)(H,25,26)/p-1 |
| InChIK | ITTMNGGKYAAUFE-UHFFFAOYSA-M |
| TotalMolweight | 410.246 |
| Molweight | 410.246 |
| MonoisotopicMass | 409.018779 |
| CLogP | 2.5284 |
| CLogS | -6.139 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 279.26 |
| Relative PSA | 0.22678 |
| PolarSurfaceArea | 81.59 |
| Druglikeness | 2.5975 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]benzoate | 2 - 4-[(Z)-[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]benzoate