| MolName | 4-[(2Z)-2-[(Z)-2-bromo-3-phenylprop-2-enylidene]hydrazinyl]benzoic acid |
| MolecularFormula | C16H13N2O2Br |
| Smiles | OC(c(cc1)ccc1N/N=C\C(\Br)=C\c1ccccc1)=O |
| InChI | InChI=1S/C16H13BrN2O2/c17-14(10-12-4-2-1-3-5-12)11-18-19-15-8-6-13(7-9-15)16(20)21/h1-11,19H,(H,20,21) |
| InChIK | IUDAOHGNPUJUAD-UHFFFAOYSA-N |
| TotalMolweight | 345.195 |
| Molweight | 345.195 |
| MonoisotopicMass | 344.016039 |
| CLogP | 4.9369 |
| CLogS | -4.287 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 236.68 |
| Relative PSA | 0.2075 |
| PolarSurfaceArea | 61.69 |
| Druglikeness | -3.1271 |
| Mutagenic | high |
| Tumorigenic | low |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2Z)-2-[(Z)-2-bromo-3-phenylprop-2-enylidene]hydrazinyl]benzoic acid | 2 - 4-[(2Z)-2-[(Z)-2-bromo-3-phenylprop-2-enylidene]hydrazinyl]benzoic acid