| MolName | (1R,2R,6S,7S)-4-[(Z)-[5-(4-fluoro-2-nitrophenyl)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| MolecularFormula | C20H14N3O5F |
| Smiles | [O-][N+](c(cc(cc1)F)c1-c1ccc(/C=N\N(C([C@H]2[C@@H]3[C@@H]4C=C[C@H]2C4)=O)C3=O)o1)=O |
| InChI | InChI=1S/C20H14FN3O5/c21-12-3-5-14(15(8-12)24(27)28)16-6-4-13(29-16)9-22-23-19(25)17-10-1-2-11(7-10)18(17)20(23)26/h1-6,8-11,17-18H,7H2/t10-,11-,17-,18+/m1/s1 |
| InChIK | IUMFFDNZDDYOGZ-BNFWDCBASA-N |
| TotalMolweight | 395.345 |
| Molweight | 395.345 |
| MonoisotopicMass | 395.09175 |
| CLogP | 1.8566 |
| CLogS | -5.502 |
| H Acceptors | 8 |
| TotalSurfaceArea | 273.05 |
| Relative PSA | 0.31375 |
| PolarSurfaceArea | 108.7 |
| Druglikeness | 0.68556 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | low |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.51724 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| StereoCenters | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 6 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 6 |
| AcidicOxygens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (1R,2R,6S,7S)-4-[(Z)-[5-(4-fluoro-2-nitrophenyl)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione | 2 - (1R,2R,6S,7S)-4-[(Z)-[5-(4-fluoro-2-nitrophenyl)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione