| MolName | (Z)-1-[2-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C20H20N4O2 |
| Smiles | C=CCc(cccc1)c1OCCOc1c(/C=N\n2cnnc2)cccc1 |
| InChI | InChI=1S/C20H20N4O2/c1-2-7-17-8-3-5-10-19(17)25-12-13-26-20-11-6-4-9-18(20)14-23-24-15-21-22-16-24/h2-6,8-11,14-16H,1,7,12-13H2 |
| InChIK | IUQLLMSSNTUUQX-UHFFFAOYSA-N |
| TotalMolweight | 348.405 |
| Molweight | 348.405 |
| MonoisotopicMass | 348.158626 |
| CLogP | 3.6117 |
| CLogS | -6.29 |
| H Acceptors | 6 |
| TotalSurfaceArea | 290.08 |
| Relative PSA | 0.20794 |
| PolarSurfaceArea | 61.53 |
| Druglikeness | -6.6521 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[2-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[2-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine