| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-anthracen-9-ylmethylideneamino]-5-[(4-fluorophenoxy)methyl]triazole-4-carboxamide |
| MolecularFormula | C27H19N8O3F |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2c(cccc3)c3cc3ccccc23)=O)c1COc(cc1)ccc1F |
| InChI | InChI=1S/C27H19FN8O3/c28-18-9-11-19(12-10-18)38-15-23-24(31-35-36(23)26-25(29)33-39-34-26)27(37)32-30-14-22-20-7-3-1-5-16(20)13-17-6-2-4-8-21(17)22/h1-14H,15H2,(H2,29,33)(H,32,37) |
| InChIK | IUYYNPMYIXKERT-UHFFFAOYSA-N |
| TotalMolweight | 522.499 |
| Molweight | 522.499 |
| MonoisotopicMass | 522.156415 |
| CLogP | 5.5871 |
| CLogS | -6.319 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 388.27 |
| Relative PSA | 0.32488 |
| PolarSurfaceArea | 146.34 |
| Druglikeness | 0.3808 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.46154 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 30 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-anthracen-9-ylmethylideneamino]-5-[(4-fluorophenoxy)methyl]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-anthracen-9-ylmethylideneamino]-5-[(4-fluorophenoxy)methyl]triazole-4-carboxamide