| MolName | 3-(1,3-benzodioxol-5-yl)-N-[(Z)-(4-fluorophenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
| MolecularFormula | C18H13N4O3F |
| Smiles | O=C(c1cc(-c(cc2)cc3c2OCO3)n[nH]1)N/N=C\c(cc1)ccc1F |
| InChI | InChI=1S/C18H13FN4O3/c19-13-4-1-11(2-5-13)9-20-23-18(24)15-8-14(21-22-15)12-3-6-16-17(7-12)26-10-25-16/h1-9H,10H2,(H,21,22)(H,23,24) |
| InChIK | IVFBUBVFLGTTPX-UHFFFAOYSA-N |
| TotalMolweight | 352.324 |
| Molweight | 352.324 |
| MonoisotopicMass | 352.097169 |
| CLogP | 3.1116 |
| CLogS | -5.121 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 261.69 |
| Relative PSA | 0.30941 |
| PolarSurfaceArea | 88.6 |
| Druglikeness | 4.1554 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-(1,3-benzodioxol-5-yl)-N-[(Z)-(4-fluorophenyl)methylideneamino]-1H-pyrazole-5-carboxamide | 2 - 3-(1,3-benzodioxol-5-yl)-N-[(Z)-(4-fluorophenyl)methylideneamino]-1H-pyrazole-5-carboxamide