| MolName | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]thiourea |
| MolecularFormula | C22H19N5OClF3S2 |
| Smiles | FC(c(cc1)cc(NC(N/N=C\c2c(-c3ccccc3)nc(N3CCOCC3)s2)=S)c1Cl)(F)F |
| InChI | InChI=1S/C22H19ClF3N5OS2/c23-16-7-6-15(22(24,25)26)12-17(16)28-20(33)30-27-13-18-19(14-4-2-1-3-5-14)29-21(34-18)31-8-10-32-11-9-31/h1-7,12-13H,8-11H2,(H2,28,30,33) |
| InChIK | IVJZMNRQKTXRBX-UHFFFAOYSA-N |
| TotalMolweight | 526.006 |
| Molweight | 526.006 |
| MonoisotopicMass | 525.067161 |
| CLogP | 6.1732 |
| CLogS | -7.559 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 374.59 |
| Relative PSA | 0.28647 |
| PolarSurfaceArea | 122.11 |
| Druglikeness | -2.4359 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 7 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]thiourea | 2 - 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]thiourea