| MolName | 2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide |
| MolecularFormula | C12H10N6O5 |
| Smiles | [O-][N+](c1c(/C=N\NC(CC(C(N2)=O)=NNC2=O)=O)cccc1)=O |
| InChI | InChI=1S/C12H10N6O5/c19-10(5-8-11(20)14-12(21)17-15-8)16-13-6-7-3-1-2-4-9(7)18(22)23/h1-4,6H,5H2,(H,16,19)(H2,14,17,20,21) |
| InChIK | IVQFDCJBKFYWNV-UHFFFAOYSA-N |
| TotalMolweight | 318.248 |
| Molweight | 318.248 |
| MonoisotopicMass | 318.071269 |
| CLogP | -0.448 |
| CLogS | -3.821 |
| H Acceptors | 11 |
| H Donors | 3 |
| TotalSurfaceArea | 232.55 |
| Relative PSA | 0.54586 |
| PolarSurfaceArea | 157.84 |
| Druglikeness | 1.9773 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6087 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide | 2 - 2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide