| MolName | 2-(3-chlorophenoxy)-N-[(Z)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]acetamide |
| MolecularFormula | C15H10N2O3Br3Cl |
| Smiles | Oc(c(Br)cc(Br)c1/C=N\NC(COc2cc(Cl)ccc2)=O)c1Br |
| InChI | InChI=1S/C15H10Br3ClN2O3/c16-11-5-12(17)15(23)14(18)10(11)6-20-21-13(22)7-24-9-3-1-2-8(19)4-9/h1-6,23H,7H2,(H,21,22) |
| InChIK | IVSBXNWSADBSOD-UHFFFAOYSA-N |
| TotalMolweight | 541.42 |
| Molweight | 541.42 |
| MonoisotopicMass | 537.793003 |
| CLogP | 5.2124 |
| CLogS | -6.443 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 288.41 |
| Relative PSA | 0.20495 |
| PolarSurfaceArea | 70.92 |
| Druglikeness | 2.4265 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-(3-chlorophenoxy)-N-[(Z)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]acetamide | 2 - 2-(3-chlorophenoxy)-N-[(Z)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]acetamide