| MolName | N-[5-[2-[(2Z)-2-[[2-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide |
| MolecularFormula | C29H23N5O3S |
| Smiles | O=C(Cc1nnc(NC(c2ccccc2)=O)s1)N/N=C\c(cccc1)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C29H23N5O3S/c35-26(17-27-33-34-29(38-27)31-28(36)21-10-2-1-3-11-21)32-30-18-22-12-5-7-16-25(22)37-19-23-14-8-13-20-9-4-6-15-24(20)23/h1-16,18H,17,19H2,(H,32,35)(H,31,34,36) |
| InChIK | IWSGBEBRNMIGFP-UHFFFAOYSA-N |
| TotalMolweight | 521.6 |
| Molweight | 521.6 |
| MonoisotopicMass | 521.15216 |
| CLogP | 5.7327 |
| CLogS | -7.352 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 401.3 |
| Relative PSA | 0.28111 |
| PolarSurfaceArea | 133.81 |
| Druglikeness | 6.2267 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60526 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[5-[2-[(2Z)-2-[[2-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide | 2 - N-[5-[2-[(2Z)-2-[[2-(naphthalen-1-ylmethoxy)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide