| MolName | 4-chloro-2-[(Z)-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)iminomethyl]-6-nitrophenolate |
| MolecularFormula | C15H14N4O5Cl |
| Smiles | [O-]c(c(/C=N\N(C(C1(CCCCC1)N1)=O)C1=O)cc(Cl)c1)c1[N+]([O-])=O |
| InChI | InChI=1S/C15H15ClN4O5/c16-10-6-9(12(21)11(7-10)20(24)25)8-17-19-13(22)15(18-14(19)23)4-2-1-3-5-15/h6-8,21H,1-5H2,(H,18,23)/p-1 |
| InChIK | IWULDMAQXGZCGN-UHFFFAOYSA-M |
| TotalMolweight | 365.752 |
| Molweight | 365.752 |
| MonoisotopicMass | 365.065273 |
| CLogP | -0.0885 |
| CLogS | -4.636 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 254.11 |
| Relative PSA | 0.38291 |
| PolarSurfaceArea | 130.65 |
| Druglikeness | -3.4588 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.52 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 8 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-2-[(Z)-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)iminomethyl]-6-nitrophenolate | 2 - 4-chloro-2-[(Z)-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)iminomethyl]-6-nitrophenolate