| MolName | N-[2-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-2-fluorobenzamide |
| MolecularFormula | C17H14N3O4F |
| Smiles | O=C(CNC(c(cccc1)c1F)=O)N/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C17H14FN3O4/c18-13-4-2-1-3-12(13)17(23)19-9-16(22)21-20-8-11-5-6-14-15(7-11)25-10-24-14/h1-8H,9-10H2,(H,19,23)(H,21,22) |
| InChIK | IXGCYANJVZKTHL-UHFFFAOYSA-N |
| TotalMolweight | 343.313 |
| Molweight | 343.313 |
| MonoisotopicMass | 343.096835 |
| CLogP | 2.4975 |
| CLogS | -4.513 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 256.57 |
| Relative PSA | 0.31379 |
| PolarSurfaceArea | 89.02 |
| Druglikeness | 3.8539 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-2-fluorobenzamide | 2 - N-[2-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-2-fluorobenzamide