| MolName | N-[(2R)-3-(1H-indol-3-yl)-1-oxo-1-[(2Z)-2-(pyridin-3-ylmethylidene)hydrazinyl]propan-2-yl]thiophene-2-carboxamide |
| MolecularFormula | C22H19N5O2S |
| Smiles | O=C([C@@H](Cc1c[nH]c2c1cccc2)NC(c1cccs1)=O)N/N=C\c1cnccc1 |
| InChI | InChI=1S/C22H19N5O2S/c28-21(27-25-13-15-5-3-9-23-12-15)19(26-22(29)20-8-4-10-30-20)11-16-14-24-18-7-2-1-6-17(16)18/h1-10,12-14,19,24H,11H2,(H,26,29)(H,27,28)/t19-/m1/s1 |
| InChIK | IXGFPEYCZSFIDJ-LJQANCHMSA-N |
| TotalMolweight | 417.492 |
| Molweight | 417.492 |
| MonoisotopicMass | 417.125945 |
| CLogP | 2.9916 |
| CLogS | -4.741 |
| H Acceptors | 7 |
| H Donors | 3 |
| TotalSurfaceArea | 321.09 |
| Relative PSA | 0.3296 |
| PolarSurfaceArea | 127.48 |
| Druglikeness | 8.6933 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| StereoCenters | 1 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - N-[(2R)-3-(1H-indol-3-yl)-1-oxo-1-[(2Z)-2-(pyridin-3-ylmethylidene)hydrazinyl]propan-2-yl]thiophene-2-carboxamide | 2 - N-[(2R)-3-(1H-indol-3-yl)-1-oxo-1-[(2Z)-2-(pyridin-3-ylmethylidene)hydrazinyl]propan-2-yl]thiophene-2-carboxamide