| MolName | 4-chloro-N-[(Z)-(4-phenylphenyl)methylideneamino]benzamide |
| MolecularFormula | C20H15N2OCl |
| Smiles | O=C(c(cc1)ccc1Cl)N/N=C\c(cc1)ccc1-c1ccccc1 |
| InChI | InChI=1S/C20H15ClN2O/c21-19-12-10-18(11-13-19)20(24)23-22-14-15-6-8-17(9-7-15)16-4-2-1-3-5-16/h1-14H,(H,23,24) |
| InChIK | IXKSTBCZURHZJR-UHFFFAOYSA-N |
| TotalMolweight | 334.805 |
| Molweight | 334.805 |
| MonoisotopicMass | 334.08729 |
| CLogP | 5.4668 |
| CLogS | -6.543 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 262.17 |
| Relative PSA | 0.13735 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 4.4715 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70833 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-N-[(Z)-(4-phenylphenyl)methylideneamino]benzamide | 2 - 4-chloro-N-[(Z)-(4-phenylphenyl)methylideneamino]benzamide