| MolName | [(Z)-[5-(1,1,2,2,3,3,3-heptafluoropropyl)isoquinolin-1-yl]methylideneamino]thiourea |
| MolecularFormula | C14H9N4F7S |
| Smiles | NC(N/N=C\c1nccc2c(C(C(C(F)(F)F)(F)F)(F)F)cccc12)=S |
| InChI | InChI=1S/C14H9F7N4S/c15-12(16,13(17,18)14(19,20)21)9-3-1-2-8-7(9)4-5-23-10(8)6-24-25-11(22)26/h1-6H,(H3,22,25,26) |
| InChIK | IYJACKLHQZCAOV-UHFFFAOYSA-N |
| TotalMolweight | 398.305 |
| Molweight | 398.305 |
| MonoisotopicMass | 398.043612 |
| CLogP | 3.8812 |
| CLogS | -5.53 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 259.75 |
| Relative PSA | 0.29725 |
| PolarSurfaceArea | 95.39 |
| Druglikeness | -63.852 |
| Mutagenic | low |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-[5-(1,1,2,2,3,3,3-heptafluoropropyl)isoquinolin-1-yl]methylideneamino]thiourea | 2 - [(Z)-[5-(1,1,2,2,3,3,3-heptafluoropropyl)isoquinolin-1-yl]methylideneamino]thiourea