| MolName | N-[2-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
| MolecularFormula | C25H19N5O5 |
| Smiles | O=C(C(C(c1c2cccc1)=NNC2=O)NC(c1ccccc1)=O)N/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C25H19N5O5/c31-23(16-6-2-1-3-7-16)27-22(21-17-8-4-5-9-18(17)24(32)30-28-21)25(33)29-26-13-15-10-11-19-20(12-15)35-14-34-19/h1-13,22H,14H2,(H,27,31)(H,29,33)(H,30,32)/t22-/m1/s1 |
| InChIK | IYXFIAUKAUFRJP-JOCHJYFZSA-N |
| TotalMolweight | 469.456 |
| Molweight | 469.456 |
| MonoisotopicMass | 469.13862 |
| CLogP | 3.2445 |
| CLogS | -6.588 |
| H Acceptors | 10 |
| H Donors | 3 |
| TotalSurfaceArea | 347.4 |
| Relative PSA | 0.33541 |
| PolarSurfaceArea | 130.48 |
| Druglikeness | 6.8148 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.45714 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| StereoCenters | 1 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon | racemate |
Click to Load Molecule:
1 - N-[2-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide | 2 - N-[2-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide