| MolName | 2-nitro-4-[(Z)-[[2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]hydrazinylidene]methyl]phenolate |
| MolecularFormula | C19H16N5O5S |
| Smiles | [O-]c(ccc(/C=N\NC(CN(C=Nc1c2c(CCCC3)c3s1)C2=O)=O)c1)c1[N+]([O-])=O |
| InChI | InChI=1S/C19H17N5O5S/c25-14-6-5-11(7-13(14)24(28)29)8-21-22-16(26)9-23-10-20-18-17(19(23)27)12-3-1-2-4-15(12)30-18/h5-8,10,25H,1-4,9H2,(H,22,26)/p-1 |
| InChIK | IZCVDDQIQUHCAF-UHFFFAOYSA-M |
| TotalMolweight | 426.432 |
| Molweight | 426.432 |
| MonoisotopicMass | 426.087215 |
| CLogP | 0.3685 |
| CLogS | -5.125 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 308.74 |
| Relative PSA | 0.41838 |
| PolarSurfaceArea | 171.25 |
| Druglikeness | -1.4613 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 7 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-nitro-4-[(Z)-[[2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]hydrazinylidene]methyl]phenolate | 2 - 2-nitro-4-[(Z)-[[2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]hydrazinylidene]methyl]phenolate