| MolName | 4-amino-N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| MolecularFormula | C14H9N6O5Cl |
| Smiles | Nc1nonc1C(N/N=C\c1ccc(-c(ccc([N+]([O-])=O)c2)c2Cl)o1)=O |
| InChI | InChI=1S/C14H9ClN6O5/c15-10-5-7(21(23)24)1-3-9(10)11-4-2-8(25-11)6-17-18-14(22)12-13(16)20-26-19-12/h1-6H,(H2,16,20)(H,18,22) |
| InChIK | IZDSECMDVGNXFT-UHFFFAOYSA-N |
| TotalMolweight | 376.715 |
| Molweight | 376.715 |
| MonoisotopicMass | 376.032296 |
| CLogP | 2.0643 |
| CLogS | -5.245 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 271.26 |
| Relative PSA | 0.4861 |
| PolarSurfaceArea | 165.36 |
| Druglikeness | 3.1363 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide | 2 - 4-amino-N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide