| MolName | 2-amino-N-[(E)-(5-iodofuran-2-yl)methylideneamino]benzamide |
| MolecularFormula | C12H10N3O2I |
| Smiles | Nc(cccc1)c1C(N/N=C/c(o1)ccc1I)=O |
| InChI | InChI=1S/C12H10IN3O2/c13-11-6-5-8(18-11)7-15-16-12(17)9-3-1-2-4-10(9)14/h1-7H,14H2,(H,16,17) |
| InChIK | IZJCWCVZWDOYPM-UHFFFAOYSA-N |
| TotalMolweight | 355.13 |
| Molweight | 355.13 |
| MonoisotopicMass | 354.981775 |
| CLogP | 2.2475 |
| CLogS | -4.258 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 211.48 |
| Relative PSA | 0.3092 |
| PolarSurfaceArea | 80.62 |
| Druglikeness | 6.815 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-amino-N-[(E)-(5-iodofuran-2-yl)methylideneamino]benzamide | 2 - 2-amino-N-[(E)-(5-iodofuran-2-yl)methylideneamino]benzamide