| MolName | N,N'-bis[(Z)-(5-chlorothiophen-2-yl)methylideneamino]butanediamide |
| MolecularFormula | C14H12N4O2Cl2S2 |
| Smiles | O=C(CCC(N/N=C\c(s1)ccc1Cl)=O)N/N=C\c(s1)ccc1Cl |
| InChI | InChI=1S/C14H12Cl2N4O2S2/c15-11-3-1-9(23-11)7-17-19-13(21)5-6-14(22)20-18-8-10-2-4-12(16)24-10/h1-4,7-8H,5-6H2,(H,19,21)(H,20,22) |
| InChIK | IZXXBNRLPLCUGZ-UHFFFAOYSA-N |
| TotalMolweight | 403.313 |
| Molweight | 403.313 |
| MonoisotopicMass | 401.97787 |
| CLogP | 4.8018 |
| CLogS | -6.184 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 291.2 |
| Relative PSA | 0.38716 |
| PolarSurfaceArea | 139.4 |
| Druglikeness | 4.3681 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 2 |
| Symmetricatoms | 12 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(5-chlorothiophen-2-yl)methylideneamino]butanediamide | 2 - N,N'-bis[(Z)-(5-chlorothiophen-2-yl)methylideneamino]butanediamide