| MolName | 2-amino-1-[(Z)-(3-nitrophenyl)methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| MolecularFormula | C23H21N7O4 |
| Smiles | Nc1c(C(NC[C@H]2OCCC2)=O)c2nc3ccccc3nc2n1/N=C\c1cccc([N+]([O-])=O)c1 |
| InChI | InChI=1S/C23H21N7O4/c24-21-19(23(31)25-13-16-7-4-10-34-16)20-22(28-18-9-2-1-8-17(18)27-20)29(21)26-12-14-5-3-6-15(11-14)30(32)33/h1-3,5-6,8-9,11-12,16H,4,7,10,13,24H2,(H,25,31)/t16-/m0/s1 |
| InChIK | JACGZKGGTYOHNT-INIZCTEOSA-N |
| TotalMolweight | 459.465 |
| Molweight | 459.465 |
| MonoisotopicMass | 459.165503 |
| CLogP | 1.8319 |
| CLogS | -8.182 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 339.14 |
| Relative PSA | 0.35534 |
| PolarSurfaceArea | 153.24 |
| Druglikeness | -0.66197 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.47059 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| StereoCenters | 1 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Sp3Atoms | 8 |
| Amides | 1 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - 2-amino-1-[(Z)-(3-nitrophenyl)methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]pyrrolo[3,2-b]quinoxaline-3-carboxamide | 2 - 2-amino-1-[(Z)-(3-nitrophenyl)methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]pyrrolo[3,2-b]quinoxaline-3-carboxamide