| MolName | 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(Z)-(4-phenylphenyl)methylideneamino]acetamide |
| MolecularFormula | C29H21N4O2ClS |
| Smiles | O=C(CSC(N1c(cc2)ccc2Cl)=Nc(cccc2)c2C1=O)N/N=C\c(cc1)ccc1-c1ccccc1 |
| InChI | InChI=1S/C29H21ClN4O2S/c30-23-14-16-24(17-15-23)34-28(36)25-8-4-5-9-26(25)32-29(34)37-19-27(35)33-31-18-20-10-12-22(13-11-20)21-6-2-1-3-7-21/h1-18H,19H2,(H,33,35) |
| InChIK | JAEIWRZWBJZJBB-UHFFFAOYSA-N |
| TotalMolweight | 525.031 |
| Molweight | 525.031 |
| MonoisotopicMass | 524.107373 |
| CLogP | 6.4757 |
| CLogS | -8.947 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 390.7 |
| Relative PSA | 0.20886 |
| PolarSurfaceArea | 99.43 |
| Druglikeness | 5.7508 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56757 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(Z)-(4-phenylphenyl)methylideneamino]acetamide | 2 - 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(Z)-(4-phenylphenyl)methylideneamino]acetamide