| MolName | 4-[(Z)-[5-(2-bromophenyl)furan-2-yl]methylideneamino]-3-(3-chlorophenyl)-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C19H12N4OBrClS |
| Smiles | S=C(NN=C1c2cc(Cl)ccc2)N1/N=C\c1ccc(-c(cccc2)c2Br)o1 |
| InChI | InChI=1S/C19H12BrClN4OS/c20-16-7-2-1-6-15(16)17-9-8-14(26-17)11-22-25-18(23-24-19(25)27)12-4-3-5-13(21)10-12/h1-11H,(H,24,27) |
| InChIK | JAFDXOAGWHBGFJ-UHFFFAOYSA-N |
| TotalMolweight | 459.754 |
| Molweight | 459.754 |
| MonoisotopicMass | 457.960369 |
| CLogP | 5.5651 |
| CLogS | -7.481 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 305.22 |
| Relative PSA | 0.26256 |
| PolarSurfaceArea | 85.22 |
| Druglikeness | 4.3321 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[5-(2-bromophenyl)furan-2-yl]methylideneamino]-3-(3-chlorophenyl)-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-[5-(2-bromophenyl)furan-2-yl]methylideneamino]-3-(3-chlorophenyl)-1H-1,2,4-triazole-5-thione