| MolName | N-[(Z)-anthracen-9-ylmethylideneamino]-2-[[5-(4-chlorophenyl)-4-cyclohexyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| MolecularFormula | C31H28N5OClS |
| Smiles | O=C(CSc1nnc(-c(cc2)ccc2Cl)n1C1CCCCC1)N/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C31H28ClN5OS/c32-24-16-14-21(15-17-24)30-35-36-31(37(30)25-10-2-1-3-11-25)39-20-29(38)34-33-19-28-26-12-6-4-8-22(26)18-23-9-5-7-13-27(23)28/h4-9,12-19,25H,1-3,10-11,20H2,(H,34,38) |
| InChIK | JAJUJALJHNPZDR-UHFFFAOYSA-N |
| TotalMolweight | 554.116 |
| Molweight | 554.116 |
| MonoisotopicMass | 553.170307 |
| CLogP | 8.0408 |
| CLogS | -9.554 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 417.14 |
| Relative PSA | 0.19732 |
| PolarSurfaceArea | 97.47 |
| Druglikeness | 0.364 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48718 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 25 |
| Sp3Atoms | 8 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-anthracen-9-ylmethylideneamino]-2-[[5-(4-chlorophenyl)-4-cyclohexyl-1,2,4-triazol-3-yl]sulfanyl]acetamide | 2 - N-[(Z)-anthracen-9-ylmethylideneamino]-2-[[5-(4-chlorophenyl)-4-cyclohexyl-1,2,4-triazol-3-yl]sulfanyl]acetamide