| MolName | [3-[(Z)-[(2-oxo-4-phenylpyrrolidine-3-carbonyl)hydrazinylidene]methyl]phenyl] 3-fluorobenzoate |
| MolecularFormula | C25H20N3O4F |
| Smiles | O=C(C(C(CN1)c2ccccc2)C1=O)N/N=C\c1cccc(OC(c2cccc(F)c2)=O)c1 |
| InChI | InChI=1S/C25H20FN3O4/c26-19-10-5-9-18(13-19)25(32)33-20-11-4-6-16(12-20)14-28-29-24(31)22-21(15-27-23(22)30)17-7-2-1-3-8-17/h1-14,21-22H,15H2,(H,27,30)(H,29,31) |
| InChIK | JAZYPIMJAMNSMF-UHFFFAOYSA-N |
| TotalMolweight | 445.449 |
| Molweight | 445.449 |
| MonoisotopicMass | 445.143785 |
| CLogP | 4.1619 |
| CLogS | -5.581 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 335.32 |
| Relative PSA | 0.24916 |
| PolarSurfaceArea | 96.86 |
| Druglikeness | 5.2738 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57576 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| StereoCenters | 2 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon | unknown chirality |
Click to Load Molecule:
1 - [3-[(Z)-[(2-oxo-4-phenylpyrrolidine-3-carbonyl)hydrazinylidene]methyl]phenyl] 3-fluorobenzoate | 2 - [3-[(Z)-[(2-oxo-4-phenylpyrrolidine-3-carbonyl)hydrazinylidene]methyl]phenyl] 3-fluorobenzoate