| MolName | N-[(Z)-(4-fluorophenyl)methylideneamino]-4-(3-nitrophenyl)-1,3-thiazol-2-amine |
| MolecularFormula | C16H11N4O2FS |
| Smiles | [O-][N+](c1cccc(-c2csc(N/N=C\c(cc3)ccc3F)n2)c1)=O |
| InChI | InChI=1S/C16H11FN4O2S/c17-13-6-4-11(5-7-13)9-18-20-16-19-15(10-24-16)12-2-1-3-14(8-12)21(22)23/h1-10H,(H,19,20) |
| InChIK | JBBNYALNXCQGST-UHFFFAOYSA-N |
| TotalMolweight | 342.353 |
| Molweight | 342.353 |
| MonoisotopicMass | 342.058674 |
| CLogP | 5.2252 |
| CLogS | -5.434 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 253.72 |
| Relative PSA | 0.33391 |
| PolarSurfaceArea | 111.34 |
| Druglikeness | -2.6248 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-fluorophenyl)methylideneamino]-4-(3-nitrophenyl)-1,3-thiazol-2-amine | 2 - N-[(Z)-(4-fluorophenyl)methylideneamino]-4-(3-nitrophenyl)-1,3-thiazol-2-amine