| MolName | N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-3-(4-phenylmethoxyphenyl)-1H-pyrazole-5-carboxamide |
| MolecularFormula | C24H18N4O2ClF |
| Smiles | O=C(c1cc(-c(cc2)ccc2OCc2ccccc2)n[nH]1)N/N=C\c(c(F)ccc1)c1Cl |
| InChI | InChI=1S/C24H18ClFN4O2/c25-20-7-4-8-21(26)19(20)14-27-30-24(31)23-13-22(28-29-23)17-9-11-18(12-10-17)32-15-16-5-2-1-3-6-16/h1-14H,15H2,(H,28,29)(H,30,31) |
| InChIK | JBBOOHURMYFHSO-UHFFFAOYSA-N |
| TotalMolweight | 448.884 |
| Molweight | 448.884 |
| MonoisotopicMass | 448.110231 |
| CLogP | 4.9543 |
| CLogS | -6.487 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 340.37 |
| Relative PSA | 0.20851 |
| PolarSurfaceArea | 79.37 |
| Druglikeness | 4.025 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-3-(4-phenylmethoxyphenyl)-1H-pyrazole-5-carboxamide | 2 - N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-3-(4-phenylmethoxyphenyl)-1H-pyrazole-5-carboxamide