| MolName | 2-[[2,6-dibromo-4-[(Z)-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenoxy]methyl]benzonitrile |
| MolecularFormula | C23H15N5OBr2S |
| Smiles | N#Cc1c(COc(c(Br)cc(/C=N\N(C(c2ccccc2)=NN2)C2=S)c2)c2Br)cccc1 |
| InChI | InChI=1S/C23H15Br2N5OS/c24-19-10-15(11-20(25)21(19)31-14-18-9-5-4-8-17(18)12-26)13-27-30-22(28-29-23(30)32)16-6-2-1-3-7-16/h1-11,13H,14H2,(H,29,32) |
| InChIK | JBDFPVBGXUOKLW-UHFFFAOYSA-N |
| TotalMolweight | 569.28 |
| Molweight | 569.28 |
| MonoisotopicMass | 566.936402 |
| CLogP | 5.9291 |
| CLogS | -8.233 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 364.21 |
| Relative PSA | 0.24598 |
| PolarSurfaceArea | 105.1 |
| Druglikeness | -2.8913 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.5625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[2,6-dibromo-4-[(Z)-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenoxy]methyl]benzonitrile | 2 - 2-[[2,6-dibromo-4-[(Z)-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenoxy]methyl]benzonitrile