| MolName | 2-[4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]acetamide |
| MolecularFormula | C17H16N3O3ClS |
| Smiles | NC(COc1ccc(/C=N\NC(CSc(cc2)ccc2Cl)=O)cc1)=O |
| InChI | InChI=1S/C17H16ClN3O3S/c18-13-3-7-15(8-4-13)25-11-17(23)21-20-9-12-1-5-14(6-2-12)24-10-16(19)22/h1-9H,10-11H2,(H2,19,22)(H,21,23) |
| InChIK | JBGJRNPQTNBKKY-UHFFFAOYSA-N |
| TotalMolweight | 377.851 |
| Molweight | 377.851 |
| MonoisotopicMass | 377.060089 |
| CLogP | 2.6826 |
| CLogS | -4.868 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 283.69 |
| Relative PSA | 0.32363 |
| PolarSurfaceArea | 119.08 |
| Druglikeness | 5.0133 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.76 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]acetamide | 2 - 2-[4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]acetamide