| MolName | 2-chloro-N-[(E)-3-[(2Z)-2-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| MolecularFormula | C22H15N3O4Cl2S |
| Smiles | O=C(/C(/NC(c(cccc1)c1Cl)=O)=C\c1cccs1)N/N=C\c(cc1OCOc1c1)c1Cl |
| InChI | InChI=1S/C22H15Cl2N3O4S/c23-16-6-2-1-5-15(16)21(28)26-18(9-14-4-3-7-32-14)22(29)27-25-11-13-8-19-20(10-17(13)24)31-12-30-19/h1-11H,12H2,(H,26,28)(H,27,29) |
| InChIK | JBIUBTNOLGKVKF-UHFFFAOYSA-N |
| TotalMolweight | 488.35 |
| Molweight | 488.35 |
| MonoisotopicMass | 487.016031 |
| CLogP | 6.0083 |
| CLogS | -7.659 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 347.71 |
| Relative PSA | 0.2901 |
| PolarSurfaceArea | 117.26 |
| Druglikeness | 7.5222 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-chloro-N-[(E)-3-[(2Z)-2-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide | 2 - 2-chloro-N-[(E)-3-[(2Z)-2-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide