| MolName | 4-[(2Z)-2-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]hydrazinyl]benzoate |
| MolecularFormula | C14H10N3O5 |
| Smiles | [O-]C(c(cc1)ccc1N/N=C\C=C\c1ccc([N+]([O-])=O)o1)=O |
| InChI | InChI=1S/C14H11N3O5/c18-14(19)10-3-5-11(6-4-10)16-15-9-1-2-12-7-8-13(22-12)17(20)21/h1-9,16H,(H,18,19)/p-1 |
| InChIK | JBJXFVMXTOQXQK-UHFFFAOYSA-M |
| TotalMolweight | 300.249 |
| Molweight | 300.249 |
| MonoisotopicMass | 300.062047 |
| CLogP | 0.8868 |
| CLogS | -4.121 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 234.38 |
| Relative PSA | 0.40456 |
| PolarSurfaceArea | 123.48 |
| Druglikeness | -0.70189 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.72727 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2Z)-2-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]hydrazinyl]benzoate | 2 - 4-[(2Z)-2-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]hydrazinyl]benzoate