| MolName | (Z)-N-(2,4-dichlorophenyl)-4-(furan-2-yl)-3-[(Z)-(4-phenoxyphenyl)methylideneamino]-1,3-thiazol-2-imine |
| MolecularFormula | C26H17N3O2Cl2S |
| Smiles | Clc(cc1)cc(Cl)c1/N=C1\SC=C(c2ccco2)N1/N=C\c(cc1)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C26H17Cl2N3O2S/c27-19-10-13-23(22(28)15-19)30-26-31(24(17-34-26)25-7-4-14-32-25)29-16-18-8-11-21(12-9-18)33-20-5-2-1-3-6-20/h1-17H |
| InChIK | JBQNTRZUMAOJAV-UHFFFAOYSA-N |
| TotalMolweight | 506.412 |
| Molweight | 506.412 |
| MonoisotopicMass | 505.041851 |
| CLogP | 7.1604 |
| CLogS | -9.085 |
| H Acceptors | 5 |
| TotalSurfaceArea | 369.8 |
| Relative PSA | 0.18434 |
| PolarSurfaceArea | 75.63 |
| Druglikeness | 3.5889 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-(2,4-dichlorophenyl)-4-(furan-2-yl)-3-[(Z)-(4-phenoxyphenyl)methylideneamino]-1,3-thiazol-2-imine | 2 - (Z)-N-(2,4-dichlorophenyl)-4-(furan-2-yl)-3-[(Z)-(4-phenoxyphenyl)methylideneamino]-1,3-thiazol-2-imine