| MolName | 4-amino-N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| MolecularFormula | C14H10N6O5 |
| Smiles | Nc1nonc1C(N/N=C\c1ccc(-c(cccc2)c2[N+]([O-])=O)o1)=O |
| InChI | InChI=1S/C14H10N6O5/c15-13-12(18-25-19-13)14(21)17-16-7-8-5-6-11(24-8)9-3-1-2-4-10(9)20(22)23/h1-7H,(H2,15,19)(H,17,21) |
| InChIK | JBQUMWYJOLIFFI-UHFFFAOYSA-N |
| TotalMolweight | 342.27 |
| Molweight | 342.27 |
| MonoisotopicMass | 342.071269 |
| CLogP | 1.4583 |
| CLogS | -4.509 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 255.84 |
| Relative PSA | 0.5154 |
| PolarSurfaceArea | 165.36 |
| Druglikeness | 3.1011 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide | 2 - 4-amino-N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide