| MolName | 4-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]phenol |
| MolecularFormula | C13H11N3O3 |
| Smiles | [O-][N+](c1ccc(/C=N\Nc(cc2)ccc2O)cc1)=O |
| InChI | InChI=1S/C13H11N3O3/c17-13-7-3-11(4-8-13)15-14-9-10-1-5-12(6-2-10)16(18)19/h1-9,15,17H |
| InChIK | JBSIXPHIUUXLNN-UHFFFAOYSA-N |
| TotalMolweight | 257.248 |
| Molweight | 257.248 |
| MonoisotopicMass | 257.080042 |
| CLogP | 3.5736 |
| CLogS | -3.313 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 199.26 |
| Relative PSA | 0.33368 |
| PolarSurfaceArea | 90.44 |
| Druglikeness | -3.1684 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.73684 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]phenol | 2 - 4-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]phenol