| MolName | [4-[(Z)-[[1-[(4-chlorophenyl)methyl]pyrazole-3-carbonyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| MolecularFormula | C27H18N4O3Cl2S |
| Smiles | O=C(c1nn(Cc(cc2)ccc2Cl)cc1)N/N=C\c(cc1)ccc1OC(c(sc1c2cccc1)c2Cl)=O |
| InChI | InChI=1S/C27H18Cl2N4O3S/c28-19-9-5-18(6-10-19)16-33-14-13-22(32-33)26(34)31-30-15-17-7-11-20(12-8-17)36-27(35)25-24(29)21-3-1-2-4-23(21)37-25/h1-15H,16H2,(H,31,34) |
| InChIK | JBUFWNIVTOXOFJ-UHFFFAOYSA-N |
| TotalMolweight | 549.437 |
| Molweight | 549.437 |
| MonoisotopicMass | 548.047665 |
| CLogP | 6.2391 |
| CLogS | -7.593 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 397.36 |
| Relative PSA | 0.24474 |
| PolarSurfaceArea | 113.82 |
| Druglikeness | 7.9429 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; 3-halo-enone |
| Shape Index | 0.64865 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[1-[(4-chlorophenyl)methyl]pyrazole-3-carbonyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate | 2 - [4-[(Z)-[[1-[(4-chlorophenyl)methyl]pyrazole-3-carbonyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate