| MolName | [4-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
| MolecularFormula | C25H18N2O4 |
| Smiles | Oc(cccc1)c1C(N/N=C\c(cc1)ccc1OC(c1cccc2ccccc12)=O)=O |
| InChI | InChI=1S/C25H18N2O4/c28-23-11-4-3-9-22(23)24(29)27-26-16-17-12-14-19(15-13-17)31-25(30)21-10-5-7-18-6-1-2-8-20(18)21/h1-16,28H,(H,27,29) |
| InChIK | JBUNFKWDANWMMW-UHFFFAOYSA-N |
| TotalMolweight | 410.428 |
| Molweight | 410.428 |
| MonoisotopicMass | 410.126658 |
| CLogP | 5.4808 |
| CLogS | -6.501 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 315.45 |
| Relative PSA | 0.22872 |
| PolarSurfaceArea | 87.99 |
| Druglikeness | 3.9978 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6129 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate | 2 - [4-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate