| MolName | 2-N-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C24H21N7O2ClF |
| Smiles | Fc(cc1)ccc1Nc1nc(N/N=C/c2ccc(-c3cccc(Cl)c3)o2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C24H21ClFN7O2/c25-17-3-1-2-16(14-17)21-9-8-20(35-21)15-27-32-23-29-22(28-19-6-4-18(26)5-7-19)30-24(31-23)33-10-12-34-13-11-33/h1-9,14-15H,10-13H2,(H2,28,29,30,31,32) |
| InChIK | JBVCSBQZYPOPOQ-UHFFFAOYSA-N |
| TotalMolweight | 493.929 |
| Molweight | 493.929 |
| MonoisotopicMass | 493.142928 |
| CLogP | 7.1076 |
| CLogS | -7.526 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 369.8 |
| Relative PSA | 0.2569 |
| PolarSurfaceArea | 100.7 |
| Druglikeness | 3.9771 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54286 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(E)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine