| MolName | (2E)-2-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylidenehydrazinylidene]-1,2-diphenylethanone |
| MolecularFormula | C35H28N2O3 |
| Smiles | O=C(/C(/c1ccccc1)=N/N=C\c(cc1)cc(OCc2ccccc2)c1OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H28N2O3/c38-35(31-19-11-4-12-20-31)34(30-17-9-3-10-18-30)37-36-24-29-21-22-32(39-25-27-13-5-1-6-14-27)33(23-29)40-26-28-15-7-2-8-16-28/h1-24H,25-26H2 |
| InChIK | JCBPNFJOWRSPBX-UHFFFAOYSA-N |
| TotalMolweight | 524.618 |
| Molweight | 524.618 |
| MonoisotopicMass | 524.209993 |
| CLogP | 7.9733 |
| CLogS | -8.49 |
| H Acceptors | 5 |
| TotalSurfaceArea | 425.3 |
| Relative PSA | 0.13181 |
| PolarSurfaceArea | 60.25 |
| Druglikeness | 2.376 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.475 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 11 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 30 |
| Sp3Atoms | 4 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - (2E)-2-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylidenehydrazinylidene]-1,2-diphenylethanone | 2 - (2E)-2-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylidenehydrazinylidene]-1,2-diphenylethanone